KnowledgeBoat Logo
|
OPEN IN APP

Chapter 2

Compound Interest — Exercise 2(B)

Class - 9 RS Aggarwal Mathematics Solutions



Exercise 2(B)

Question 1

Calculate the amount and the compound interest on ₹ 10,000 for 2 years at 8% p.a., compounded annually.

Answer

Given,

P = ₹ 10,000

n = 2 years

r = 8%

By formula,

A=P(1+r100)nA = P\Big(1 + \dfrac{r}{100}\Big)^n

Substituting values we get :

A=10000(1+8100)2A=10000(100+8100)2A=10000(108100)2A=10000(2725)2A=10000×729625A=11,664\Rightarrow A = 10000\Big(1 + \dfrac{8}{100}\Big)^2 \\[1em] \Rightarrow A = 10000\Big(\dfrac{100+8}{100}\Big)^2 \\[1em] \Rightarrow A = 10000\Big(\dfrac{108}{100}\Big)^2 \\[1em] \Rightarrow A = 10000\Big(\dfrac{27}{25}\Big)^2 \\[1em] \Rightarrow A = 10000 \times \dfrac{729}{625} \\[1em] \Rightarrow A = ₹ 11,664

Compound interest = Final amount - Initial principal

= ₹ 11,664 - ₹ 10,000 = ₹ 1,664

Hence, amount = ₹ 11,664 and compound interest = ₹ 1,664.

Question 2

Calculate the amount and the compound interest on ₹ 64,000 for 3 years at 7127\dfrac{1}{2}% per annum, compounded annually.

Answer

Given,

P = ₹ 64,000

n = 3 years

r = 7127\dfrac{1}{2}% = 7.5%

By formula,

A=P(1+r100)nA = P\Big(1 + \dfrac{r}{100}\Big)^n

Substituting values we get :

A=64000(1+7.5100)3A=64000(100+7.5100)3A=64000(107.5100)3A=64000×(21.520)3A=64000×9938.3758000A=79,507.\Rightarrow A = 64000\Big(1 + \dfrac{7.5}{100}\Big)^3 \\[1em] \Rightarrow A = 64000\Big(\dfrac{100+7.5}{100}\Big)^3 \\[1em] \Rightarrow A = 64000\Big(\dfrac{107.5}{100}\Big)^3 \\[1em] \Rightarrow A = 64000 \times \Big(\dfrac{21.5}{20}\Big)^3 \\[1em] \Rightarrow A = 64000 \times \dfrac{9938.375}{8000} \\[1em] \Rightarrow A = ₹ 79,507.

Compound interest = Final amount - Initial principal = ₹ 79,507 - ₹ 64,000 = ₹ 15,507

Hence, amount = ₹ 79,507 and compound interest = ₹ 15,507.

Question 3

How much will ₹ 12,000 amount to in 2 years at compound interest, the rates of interest for successive years being 10% and 11% respectively ?

Answer

Given,

P = ₹ 12,000

r1 = 10%

r2 = 11%

n = 2 years

By formula,

A = P(1+r1100)(1+r2100)P\Big(1 + \dfrac{r_1}{100}\Big)\Big(1 + \dfrac{r_2}{100}\Big)

Substituting values we get :

A=12000×(1+10100)×(1+11100)=12000×110100×111100=12000×1110×111100=12000×11×11110×100=14,652.\Rightarrow A = 12000 \times \Big(1 + \dfrac{10}{100}\Big) \times \Big(1 + \dfrac{11}{100}\Big) \\[1em] = 12000 \times \dfrac{110}{100} \times \dfrac{111}{100} \\[1em] = 12000 \times \dfrac{11}{10} \times \dfrac{111}{100} \\[1em] = \dfrac{12000 \times 11 \times 111}{10 \times 100} \\[1em] = ₹ 14,652.

Hence, final amount = ₹ 14,652.

Question 4

Calculate the amount and the compound interest on ₹ 25,000 for 3 years, the rates of interest for the successive years being 8%, 9% and 10%, compounded annually.

Answer

Given,

P = ₹ 25,000

r1 = 8%

r2 = 9%

r3 = 10%

n = 3 years

By formula,

A = P(1+r1100)(1+r2100)(1+r3100)P\Big(1 + \dfrac{r_1}{100}\Big)\Big(1 + \dfrac{r_2}{100}\Big)\Big(1 + \dfrac{r_3}{100}\Big)

Substituting values we get :

A=25000×(1+8100)×(1+9100)×(1+10100)=25000×108100×109100×110100=25000×2725×109100×1110=25000×27×109×1125×100×10=27×109×11=32,373.\Rightarrow A = 25000 \times \Big(1 + \dfrac{8}{100}\Big) \times \Big(1 + \dfrac{9}{100}\Big) \times \Big(1 + \dfrac{10}{100}\Big) \\[1em] = 25000 \times \dfrac{108}{100} \times \dfrac{109}{100} \times \dfrac{110}{100} \\[1em] = 25000 \times \dfrac{27}{25} \times \dfrac{109}{100} \times \dfrac{11}{10}\\[1em] = \dfrac{25000 \times 27 \times 109 \times 11}{25 \times 100 \times 10} \\[1em] = 27 \times 109 \times 11 \\[1em] = ₹ 32,373.

Compound interest = Final amount - Initial principal

= ₹ 32,373 - ₹ 25,000

= ₹ 7,373.

Hence, amount = ₹ 32,373 and compound interest = ₹ 7,373.

Question 5

Find the amount and the compound interest on ₹ 7,500 for 2 years 8 months at 10% p.a., compounded annually.

Answer

Given,

P = ₹ 7,500

n = 2 years 8 months

= 2 812\dfrac{8}{12} years = 2 23\dfrac{2}{3} years

r = 10%

By formula,

A=P(1+r100)n(1+23r100)A = P\Big(1 + \dfrac{r}{100}\Big)^n \Big(1 + \dfrac{\dfrac{2}{3}r}{100}\Big)

Substituting values we get :

A=7500(1+10100)2(1+23×10100)A=7500(100+10100)2(1+20300)A=7500(110100)2(300+20300)A=7500(1110)2(320300)A=7500×121100×3230A=9,680\Rightarrow A = 7500\Big(1 + \dfrac{10}{100}\Big)^2 \Big(1 + \dfrac{\dfrac{2}{3} \times 10}{100}\Big) \\[1em] \Rightarrow A = 7500\Big(\dfrac{100+10}{100}\Big)^2 \Big(1 + \dfrac{20}{300}\Big) \\[1em] \Rightarrow A = 7500\Big(\dfrac{110}{100}\Big)^2 \Big(\dfrac{300 + 20}{300}\Big) \\[1em] \Rightarrow A = 7500\Big(\dfrac{11}{10}\Big)^2 \Big(\dfrac{320}{300}\Big)\\[1em] \Rightarrow A = 7500 \times \dfrac{121}{100} \times \dfrac{32}{30}\\[1em] \Rightarrow A = ₹ 9,680

C.I. = A - P = ₹ 9,680 - ₹ 7,500 = ₹ 2,180

Hence, amount = ₹ 9,680 and compound interest = ₹ 2,180.

Question 6

If simple interest on sum of money for 3 years at 8% per annum is ₹ 7,500, find the compound interest on the same sum for the same period at same rate.

Answer

Given,

I = ₹ 7,500

T = 3 years

R = 8% p.a. simple interest

I = P×R×T100\dfrac{P \times R \times T}{100}

7500=P×8×31007500=P×24100P=7500×10024P=31,250.\Rightarrow 7500 = \dfrac{P \times 8 \times 3}{100} \\[1em] \Rightarrow 7500 = \dfrac{P \times 24}{100} \\[1em] \Rightarrow P = \dfrac{7500 \times 100}{24} \\[1em] \Rightarrow P = ₹ 31,250.

Let's calculate compound interest for this principal, rate of interest and time.

By formula,

A=P(1+r100)nA = P\Big(1 + \dfrac{r}{100}\Big)^n

A=31250(1+8100)3A=31250(100+8100)3A=31250(108100)3A=31250(2725)3A=31250×1968315625A=39366.\Rightarrow A = 31250\Big(1 + \dfrac{8}{100}\Big)^3 \\[1em] \Rightarrow A = 31250\Big(\dfrac{100+8}{100}\Big)^3 \\[1em] \Rightarrow A = 31250\Big(\dfrac{108}{100}\Big)^3 \\[1em] \Rightarrow A = 31250\Big(\dfrac{27}{25}\Big)^3 \\[1em] \Rightarrow A = 31250 \times \dfrac{19683}{15625} \\[1em] \Rightarrow A = ₹ 39366.

Compound interest = Final amount - Initial principal

= ₹ 39,366 - ₹ 31,250 = ₹ 8,116.

Hence, compound interest = ₹ 8,116.

Question 7

Calculate the amount and compound interest on ₹ 16,000 for 1 year at 15% per annum, compounded half yearly.

Answer

Given,

Principal (P) = ₹ 16,000

Time (n) = 1 year

Rate (r) = 15% compounded half-yearly

When rate of interest is compounded half-yearly :

By formula,

A = P(1+r2×100)n×2P\Big(1 + \dfrac{r}{2 \times 100}\Big)^{n \times 2}

Substituting values we get :

A=16000×(1+152×100)1×2A=16000×(200+15200)2A=16000×(215200)2A=16000×(4340)2A=16000×(18491600)A=16000×18491600=18,490.\Rightarrow A = 16000 \times \Big(1 + \dfrac{15}{2 \times 100}\Big)^{1 \times 2} \\[1em] \Rightarrow A = 16000 \times \Big(\dfrac{200+15}{200}\Big)^2 \\[1em] \Rightarrow A = 16000 \times \Big(\dfrac{215}{200}\Big)^2 \\[1em] \Rightarrow A = 16000 \times \Big(\dfrac{43}{40}\Big)^2 \\[1em] \Rightarrow A = 16000 \times \Big(\dfrac{1849}{1600}\Big) \\[1em] \Rightarrow A = \dfrac{16000 \times 1849}{1600} = ₹ 18,490.

Compound interest = Amount - Principal = ₹ 18,490 - ₹ 16,000 = ₹ 2,490

Hence, amount = ₹ 18,490 and compound interest = ₹ 2,490.

Question 8

Find the amount and compound interest on ₹ 1,25,000 for 1121\dfrac{1}{2} years at 12% per annum, compounded half yearly.

Answer

Given,

Principal (P) = ₹ 1,25,000

Time (n) = 1 12\dfrac{1}{2} years = 1.5 years

Rate (r) = 12% compounded half-yearly

When rate of interest is compounded half-yearly :

By formula,

A = P(1+r2×100)n×2P\Big(1 + \dfrac{r}{2 \times 100}\Big)^{n \times 2}

Substituting values we get :

A=125000×(1+122×100)1.5×2A=125000×(1+350)3A=125000×(50+350)3A=125000×(5350)3A=125000×(148877125000)A=125000×148877125000=1,48,877\Rightarrow A = 125000 \times \Big(1 + \dfrac{12}{2 \times 100}\Big)^{1.5 \times 2} \\[1em] \Rightarrow A = 125000 \times \Big(1 + \dfrac{3}{50}\Big)^3 \\[1em] \Rightarrow A = 125000 \times \Big(\dfrac{50 + 3}{50}\Big)^3 \\[1em] \Rightarrow A = 125000 \times \Big(\dfrac{53}{50}\Big)^3 \\[1em] \Rightarrow A = 125000 \times \Big(\dfrac{148877}{125000}\Big) \\[1em] \Rightarrow A = \dfrac{125000 \times 148877}{125000} = ₹ 1,48,877

Compound interest = Amount - Principal

= ₹ 1,48,877 - ₹ 1,25,000 = ₹ 23,877

Hence, amount = ₹ 1,48,877 and compound interest = ₹ 23,877.

Question 9

A sum of ₹ 12,500 is deposited for 1121\dfrac{1}{2} years, compounded half yearly. It amounts to ₹ 13,000 at the end of first half year. Find:

(i) The rate of interest

(ii) The final amount. Give your answer correct to the nearest rupee.

Answer

(i) Given,

P = ₹ 12,500

n = 1 half year

Amount = ₹ 13,000

When rate of interest is compounded half-yearly :

By formula,

A=P(1+r2×100)2×nA = P\Big(1 + \dfrac{r}{2 \times 100}\Big)^{2 \times n}

For first half year:

13000=12500(1+R2×100)0.5×21300012500=(1+R200)11.041=(R200)0.04=(R200)R=0.04×200R=8\Rightarrow 13000 = 12500\Big(1 + \dfrac{R}{2 \times 100}\Big)^{0.5 \times 2} \\[1em] \Rightarrow \dfrac{13000}{12500}= \Big(1 + \dfrac{R}{200}\Big)^1 \\[1em] \Rightarrow 1.04 - 1 = \Big(\dfrac{R}{200}\Big) \\[1em] \Rightarrow 0.04 = \Big(\dfrac{R}{200}\Big) \\[1em] \Rightarrow R = 0.04 \times 200 \\[1em] \Rightarrow R = 8%

Hence, Rate of interest = 8% p.a .

(ii) Given,

P = ₹ 12,500

n = 1.5 years

R = 8%

Let's calculate compound interest:

When rate of interest is compounded half-yearly :

By formula,

A=P(1+r2×100)2×nA = P\Big(1 + \dfrac{r}{2 \times 100}\Big)^{2 \times n}

A=12500(1+82×100)2×1.5A=12500(200+8200)3A=12500(208200)3A=12500(2625)3A=12500×1757615625A=14,060.8014,061\Rightarrow A = 12500 \Big(1 + \dfrac{8}{2 \times 100}\Big)^{2 \times 1.5} \\[1em] \Rightarrow A = 12500 \Big(\dfrac{200 + 8}{200}\Big)^3 \\[1em] \Rightarrow A = 12500 \Big(\dfrac{208}{200}\Big)^3 \\[1em] \Rightarrow A = 12500 \Big(\dfrac{26}{25}\Big)^3 \\[1em] \Rightarrow A = 12500 \times \dfrac{17576}{15625} \\[1em] \Rightarrow A = ₹ 14,060.80 \approx ₹ 14,061

Hence, compound interest = ₹ 14,061.

Question 10

The simple interest on a sum of money at 12% per annum for 1 year is ₹ 900. Find :

(i) the sum of money and

(ii) the compound interest on this sum for 1 year, payable half-yearly at the same rate.

Answer

(i) Given,

I = ₹ 900

R = 12%

T = 1 year

I = P×R×T100\dfrac{P \times R \times T}{100}

900=P×12×1100900=P×12100P=900×10012P=7,500.\Rightarrow 900 = \dfrac{P \times 12 \times 1}{100}\\[1em] \Rightarrow 900 = \dfrac{P \times 12}{100}\\[1em] \Rightarrow P = \dfrac{900 \times 100}{12} \\[1em] \Rightarrow P = ₹ 7,500.

Hence, principal = ₹ 7,500.

(ii) When rate of interest is compounded half-yearly :

By formula,

A=P(1+r2×100)2×nA = P\Big(1 + \dfrac{r}{2 \times 100}\Big)^{2 \times n}

Substituting values we get :

A=7500(1+122×100)2×1A=7500(200+12200)2A=7500(212200)2A=7500(1.06)2A=7500×1.1236A=8,427\Rightarrow A = 7500 \Big(1 + \dfrac{12}{2 \times 100}\Big)^{2 \times 1} \\[1em] \Rightarrow A = 7500 \Big(\dfrac{200 + 12}{200}\Big)^2 \\[1em] \Rightarrow A = 7500 \Big(\dfrac{212}{200}\Big)^2 \\[1em] \Rightarrow A = 7500 \Big(1.06\Big)^2 \\[1em] \Rightarrow A = 7500 \times 1.1236 \\[1em] \Rightarrow A = ₹ 8,427

By formula,

Compound interest = Amount - Principal = ₹ 8,427 - ₹ 7500 = ₹ 927.

Hence, compound interest = ₹ 927.

Question 11

What sum of money will amount to ₹ 18,150 in 2 years at 10% per annum, compounded annually?

Answer

Let sum of money be ₹ x.

Given,

P = ₹ x

r = 10%

n = 2 years

A = ₹ 18,150

By formula,

A = P(1+r100)nP\Big(1 + \dfrac{r}{100}\Big)^n

Substituting values we get :

18150=x×(1+10100)218150=x×(110100)218150=x×(1110)218150=x×121100x=18150×100121x=15,000.\Rightarrow 18150 = x \times \Big(1 + \dfrac{10}{100}\Big)^2 \\[1em] \Rightarrow 18150 = x \times \Big(\dfrac{110}{100}\Big)^2 \\[1em] \Rightarrow 18150 = x \times \Big(\dfrac{11}{10}\Big)^2 \\[1em] \Rightarrow 18150 = x \times \dfrac{121}{100} \\[1em] \Rightarrow x = \dfrac{18150 \times 100}{121} \\[1em] \Rightarrow x = ₹ 15,000.

Hence, sum of money = ₹ 15,000.

Question 12

What sum of money will amount to ₹ 93,170 in 3 years at 10% per annum, compounded annually?

Answer

Let sum of money be ₹ x.

Given,

P = ₹ x

r = 10%

n = 3 years

A = ₹ 93,170

By formula,

A = P(1+r100)nP\Big(1+ \dfrac{r}{100}\Big)^n

Substituting values we get :

93170=x×(1+10100)393170=x×(110100)393170=x×(1110)393170=x×13311000x=93170×10001331x=70,000.\Rightarrow 93170 = x \times \Big(1 + \dfrac{10}{100}\Big)^3 \\[1em] \Rightarrow 93170 = x \times \Big(\dfrac{110}{100}\Big)^3 \\[1em] \Rightarrow 93170 = x \times \Big(\dfrac{11}{10}\Big)^3 \\[1em] \Rightarrow 93170 = x \times \dfrac{1331}{1000} \\[1em] \Rightarrow x = \dfrac{93170 \times 1000}{1331} \\[1em] \Rightarrow x = ₹ 70,000.

Hence, sum of money = ₹ 70,000.

Question 13

On what sum of money will the compound interest for 2 years at 8% per annum be ₹ 7,488?

Answer

Let sum of money be ₹ x.

Given,

P = ₹ x

n = 2 years

r = 8%

C.I. = ₹ 7,488

A = P + I = ₹ x + ₹ 7,488

By formula,

A = P(1+r100)nP\Big(1 + \dfrac{r}{100}\Big)^n

Substituting values we get :

x+7488=x×(1+8100)2x+7488=x×(108100)2x+7488=x×(2725)2x+7488=x×729625625(x+7488)=729x625x+4680000=729x729x625x=4680000104x=4680000x=4680000104x=45,000.\Rightarrow x + 7488 = x \times \Big(1 + \dfrac{8}{100}\Big)^2 \\[1em] \Rightarrow x + 7488 = x \times \Big(\dfrac{108}{100}\Big)^2 \\[1em] \Rightarrow x + 7488 = x \times \Big(\dfrac{27}{25}\Big)^2 \\[1em] \Rightarrow x + 7488 = x \times \dfrac{729}{625} \\[1em] \Rightarrow 625(x + 7488) = 729x \\[1em] \Rightarrow 625x + 4680000 = 729x \\[1em] \Rightarrow 729x - 625x = 4680000 \\[1em] \Rightarrow 104x = 4680000 \\[1em] \Rightarrow x = \dfrac{4680000}{104} \\[1em] \Rightarrow x = ₹ 45,000.

Hence, sum of money = ₹ 45,000.

Question 14

The difference between the simple interest and the compound interest on a sum of money for 2 years at 12% per annum is ₹ 216. Find the sum.

Answer

Given,

n = 2 years

r = 12%

Let sum of money be ₹ P.

C.I. = A - P

C.I.=P(1+r100)nP=P(1+12100)2P=P×(112100)2P=P×(2825)2P=P×784625P=784P625P=784P625P625=159P625.C.I. = P\Big(1 + \dfrac{r}{100}\Big)^n - P \\[1em] = P\Big(1 + \dfrac{12}{100}\Big)^2 - P \\[1em] = P \times \Big(\dfrac{112}{100}\Big)^2 - P \\[1em] = P \times \Big(\dfrac{28}{25}\Big)^2 - P\\[1em] = P \times \dfrac{784}{625} - P \\[1em] = \dfrac{784P}{625} - P \\[1em] = \dfrac{784P - 625P}{625} \\[1em] = \dfrac{159P}{625}.

By formula,

T = 2 years

S.I.=P×R×T100=P×12×2100=6P25.S.I. = \dfrac{P \times R \times T}{100} \\[1em] = \dfrac{P \times 12 \times 2}{100} \\[1em] = \dfrac{6P}{25}.

Given,

Difference between S.I. and C.I. = ₹ 216

159P6256P25=216159P150P625=2169P625=216P=216×6259P=24×625P=15,000.\Rightarrow \dfrac{159P}{625} - \dfrac{6P}{25} = 216 \\[1em] \Rightarrow \dfrac{159P - 150P}{625} = 216 \\[1em] \Rightarrow \dfrac{9P}{625} = 216 \\[1em] \Rightarrow P = \dfrac{216 \times 625}{9} \\[1em] \Rightarrow P = 24 \times 625 \\[1em] \Rightarrow P = ₹ 15,000.

Hence, sum = ₹ 15,000.

Question 15

The difference between the simple interest and the compound interest on a sum of money for 3 years at 10% per annum is ₹ 558. Find the sum.

Answer

Given,

n = 3 years

r = 10 %

Let sum of money be ₹ P.

C.I. = A - P

C.I.=P(1+r100)nP=P(1+10100)3P=P×(110100)3P=P×(1110)3P=P×13311000P=1331P1000P=1331P1000P1000=331P1000.C.I. = P\Big(1 + \dfrac{r}{100}\Big)^n - P \\[1em] = P\Big(1 + \dfrac{10}{100}\Big)^3 - P \\[1em] = P \times \Big(\dfrac{110}{100}\Big)^3 - P \\[1em] = P \times \Big(\dfrac{11}{10}\Big)^3 - P\\[1em] = P \times \dfrac{1331}{1000} - P \\[1em] = \dfrac{1331P}{1000} - P \\[1em] = \dfrac{1331P - 1000P}{1000} \\[1em] = \dfrac{331P}{1000}.

Calculating S.I.,

R = 10%

T = 3 years

S.I.=P×R×T100=P×10×3100=3P10.S.I. = \dfrac{P \times R \times T}{100} \\[1em] = \dfrac{P \times 10 \times 3}{100} \\[1em] = \dfrac{3P}{10}.

Given,

Difference between S.I. and C.I. = ₹ 558

331P10003P10=558331P300P1000=55831P1000=558P=558×100031P=18×1000P=18,000.\Rightarrow \dfrac{331P}{1000} - \dfrac{3P}{10} = 558 \\[1em] \Rightarrow \dfrac{331P - 300P}{1000} = 558 \\[1em] \Rightarrow \dfrac{31P}{1000} = 558 \\[1em] \Rightarrow P = \dfrac{558 \times 1000}{31} \\[1em] \Rightarrow P = 18 \times 1000 \\[1em] \Rightarrow P = ₹ 18,000.

Hence, the sum = ₹ 18,000.

Question 16

The difference between the compound interest for 1 year, compounded half-yearly and the simple interest for 1 year on a certain sum of money at 10% per annum is ₹ 360. Find the sum.

Answer

Let sum of money lent out be ₹ x.

Calculating C.I. payable half-yearly :

P = ₹ x

r = 10%

n = 1 year

C.I. = A - P

When rate of interest is compounded half-yearly :

By formula,

A = P(1+r2×100)2nP\Big(1 + \dfrac{r}{2 \times 100}\Big)^{2n}

C.I. = A - P

Substituting values we get :

C.I.=P(1+r2×100)n×2P=x×(1+10200)1×2x=x×(210200)2x=x×(2120)2x=441x400x=441x400x400=41x400.C.I. = P\Big(1 + \dfrac{r}{2 \times 100}\Big)^{n \times 2} - P \\[1em] = x \times \Big(1 + \dfrac{10}{200}\Big)^{1 \times 2} - x \\[1em] = x \times \Big(\dfrac{210}{200}\Big)^2 - x \\[1em] = x \times \Big(\dfrac{21}{20}\Big)^2 - x \\[1em] = \dfrac{441x}{400} - x \\[1em] = \dfrac{441x - 400x}{400} \\[1em] = ₹ \dfrac{41x}{400}.

Calculating S.I. :

T = 1 year

R = 10%

S.I.=P×R×T100=x×10×1100=x10.S.I. = \dfrac{P \times R \times T}{100} \\[1em] = \dfrac{x \times 10 \times 1}{100} \\[1em] = ₹ \dfrac{x}{10}.

Given,

Difference between compound interest for a year payable half-yearly and simple interest on ₹ x lent out at 10% for a year is ₹ 360.

41x400x10=36041x40x400=360x400=360x=360×400=1,44,000.\therefore \dfrac{41x}{400} - \dfrac{x}{10} = 360 \\[1em] \Rightarrow \dfrac{41x - 40x}{400} = 360 \\[1em] \Rightarrow \dfrac{x}{400} = 360 \\[1em] \Rightarrow x = 360 \times 400 = ₹ 1,44,000.

Hence, the sum = ₹ 1,44,000.

Question 17

At what rate per cent per annum compound interest will ₹ 6,250 amount to ₹ 7,290 in 2 years?

Answer

Given,

P = ₹ 6,250

A = ₹ 7,290

n = 2 years

Let rate of interest be r%.

By formula,

A = P(1+r100)nP\Big(1 + \dfrac{r}{100}\Big)^n

Substituting values we get :

7290=6250×(1+r100)272906250=(1+r100)2729625=(1+r100)2(2725)2=(1+r100)22725=1+r10027251=r100272525=r100225=r100r=20025=8\Rightarrow 7290 = 6250 \times \Big(1 + \dfrac{r}{100}\Big)^2 \\[1em] \Rightarrow \dfrac{7290}{6250} = \Big(1 + \dfrac{r}{100}\Big)^2 \\[1em] \Rightarrow \dfrac{729}{625} = \Big(1 + \dfrac{r}{100}\Big)^2 \\[1em] \Rightarrow \Big(\dfrac{27}{25}\Big)^2 = \Big(1 + \dfrac{r}{100}\Big)^2 \\[1em] \Rightarrow \dfrac{27}{25} = 1 + \dfrac{r}{100} \\[1em] \Rightarrow \dfrac{27}{25} - 1 = \dfrac{r}{100} \\[1em] \Rightarrow \dfrac{27 - 25}{25} = \dfrac{r}{100} \\[1em] \Rightarrow \dfrac{2}{25} = \dfrac{r}{100} \\[1em] \Rightarrow r = \dfrac{200}{25} = 8%.

Hence, rate of interest = 8% p.a.

Question 18

At what rate per cent per annum will ₹ 3,000 amount to ₹ 3,993 in 3 years, the interest being compounded annually?

Answer

Given,

P = ₹ 3,000

A = ₹ 3,993

n = 3 years

Let rate of interest be r%.

By formula,

A = P(1+r100)nP\Big(1 + \dfrac{r}{100}\Big)^n

Substituting values we get :

3993=3000×(1+r100)339933000=(1+r100)313311000=(1+r100)3(1110)3=(1+r100)31110=1+r10011101=r100111010=r100110=r100r=10010=10\Rightarrow 3993 = 3000 \times \Big(1 + \dfrac{r}{100}\Big)^3 \\[1em] \Rightarrow \dfrac{3993}{3000} = \Big(1 + \dfrac{r}{100}\Big)^3 \\[1em] \Rightarrow \dfrac{1331}{1000} = \Big(1 + \dfrac{r}{100}\Big)^3 \\[1em] \Rightarrow \Big(\dfrac{11}{10}\Big)^3 = \Big(1 + \dfrac{r}{100}\Big)^3 \\[1em] \Rightarrow \dfrac{11}{10} = 1 + \dfrac{r}{100} \\[1em] \Rightarrow \dfrac{11}{10} - 1 = \dfrac{r}{100} \\[1em] \Rightarrow \dfrac{11 - 10}{10} = \dfrac{r}{100} \\[1em] \Rightarrow \dfrac{1}{10} = \dfrac{r}{100} \\[1em] \Rightarrow r = \dfrac{100}{10} = 10%.

Hence, rate of interest = 10% p.a.

Question 19

In what time will ₹ 5,120 amount to ₹ 7,290 at 121212\dfrac{1}{2}% per annum, compounded annually?

Answer

Given,

P = ₹ 5,120

Rate = 121212\dfrac{1}{2}% = 12.5%

A = ₹ 7,290

Let time required be n years.

A=P(1+r100)n7290=5120×(1+12.5100)n72905120=(100+12.5100)n729512=(112.5100)n729512=(11251000)n729512=(98)n(98)3=(98)nn=3\Rightarrow A = P\Big(1 + \dfrac{r}{100}\Big)^{n } \\[1em] \Rightarrow 7290 = 5120 \times \Big(1 + \dfrac{12.5}{100}\Big)^{n} \\[1em] \Rightarrow \dfrac{7290}{5120} = \Big(\dfrac{100 + 12.5}{100}\Big)^{n} \\[1em] \Rightarrow \dfrac{729}{512} = \Big(\dfrac{112.5}{100}\Big)^{n} \\[1em] \Rightarrow \dfrac{729}{512} = \Big(\dfrac{1125}{1000}\Big)^{n} \\[1em] \Rightarrow \dfrac{729}{512} = \Big(\dfrac{9}{8}\Big)^{n} \\[1em] \Rightarrow \Big(\dfrac{9}{8}\Big)^3 = \Big(\dfrac{9}{8}\Big)^{n} \\[1em] \Rightarrow n = 3

Hence, required time = 3 years.

Question 20

A certain sum of money amounts to ₹ 7,260 in 2 years and to ₹ 7,986 in 3 years, interest being compounded annually. Find the rate per cent per annum.

Answer

Let original sum of money invested be ₹ x and rate of percent be r%.

By formula,

A = P(1+r100)nP\Big(1 + \dfrac{r}{100}\Big)^n

Given,

The sum of money, invested at compound interest, amounts to ₹ 7,260 in 2 years.

A=P(1+r100)n7260=x×(1+r100)27260=x(1+r100)2......(1)\Rightarrow A = P\Big(1 + \dfrac{r}{100}\Big)^n \\[1em] \Rightarrow 7260 = x \times \Big(1 + \dfrac{r}{100}\Big)^2 \\[1em] \Rightarrow 7260 = x\Big(1 + \dfrac{r}{100}\Big)^2 ......(1)

The sum of money, invested at compound interest, amounts to ₹ 7,986 in 3 years.

A=P(1+r100)n7986=x×(1+r100)37986=x(1+r100)3......(2)\Rightarrow A = P\Big(1 + \dfrac{r}{100}\Big)^n \\[1em] \Rightarrow 7986 = x \times \Big(1 + \dfrac{r}{100}\Big)^3 \\[1em] \Rightarrow 7986 = x\Big(1 + \dfrac{r}{100}\Big)^3 ......(2)

Dividing equation (2) by (1), we get :

79867260=x(1+r100)3x(1+r100)213311210=(1+r100)(1+r100)=13311210r100=133112101r100=133112101210r100=1211210r=100×1211210=10\Rightarrow \dfrac{7986}{7260} = \dfrac{x\Big(1 + \dfrac{r}{100}\Big)^3}{x\Big(1 + \dfrac{r}{100}\Big)^2} \\[1em] \Rightarrow \dfrac{1331}{1210} = \Big(1 + \dfrac{r}{100}\Big) \\[1em] \Rightarrow \Big(1 + \dfrac{r}{100}\Big) = \dfrac{1331}{1210} \\[1em] \Rightarrow \dfrac{r}{100} = \dfrac{1331}{1210} - 1 \\[1em] \Rightarrow \dfrac{r}{100} = \dfrac{1331 - 1210}{1210} \\[1em] \Rightarrow \dfrac{r}{100} = \dfrac{121}{1210} \\[1em] \Rightarrow r = \dfrac{100 \times 121}{1210} = 10%.

Hence, rate percent = 10% p.a.

PrevNext